C18H32ClN3O3 — CID 123986094
N-(3-acetamido-2,2-dimethylpropyl)-2-amino-N-[3-(2-chlorohexa-2,4-dien-3-yloxy)propyl]acetamide (PubChem CID 123986094) has the molecular formula C18H32ClN3O3 and a molecular weight of 373.93 g/mol. Its IUPAC name is N-(3-acetamido-2,2-dimethylpropyl)-2-amino-N-[3-(2-chlorohexa-2,4-dien-3-yloxy)propyl]acetamide.
| Compound Name | N-(3-acetamido-2,2-dimethylpropyl)-2-amino-N-[3-(2-chlorohexa-2,4-dien-3-yloxy)propyl]acetamide |
|---|---|
| PubChem CID | 123986094 |
| Molecular Formula | C18H32ClN3O3 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | N-(3-acetamido-2,2-dimethylpropyl)-2-amino-N-[3-(2-chlorohexa-2,4-dien-3-yloxy)propyl]acetamide |
| SMILES | CC=CC(OCCCN(CC(C)(C)CNC(C)=O)C(=O)CN)=C(C)Cl |
| InChI | InChI=1S/C18H32ClN3O3/c1-6-8-16(14(2)19)25-10-7-9-22(17(24)11-20)13-18(4,5)12-21-15(3)23/h6,8H,7,9-13,20H2,1-5H3,(H,21,23) |
| InChIKey | QSMRMGYYWOHPLY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|