C23H22ClN5O3 — CID 123986415
[1-(3-chlorophenyl)cyclopropyl] 2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 123986415) has the molecular formula C23H22ClN5O3 and a molecular weight of 451.91 g/mol. Its IUPAC name is [1-(3-chlorophenyl)cyclopropyl] 2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [1-(3-chlorophenyl)cyclopropyl] 2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 123986415 |
| Molecular Formula | C23H22ClN5O3 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [1-(3-chlorophenyl)cyclopropyl] 2-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(OC1(c2cccc(Cl)c2)CC1)N1CC2CN(C(=O)c3ccc4n[nH]nc4c3)CC2C1 |
| InChI | InChI=1S/C23H22ClN5O3/c24-18-3-1-2-17(9-18)23(6-7-23)32-22(31)29-12-15-10-28(11-16(15)13-29)21(30)14-4-5-19-20(8-14)26-27-25-19/h1-5,8-9,15-16H,6-7,10-13H2,(H,25,26,27) |
| InChIKey | YNYFAGSWZRKXKD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |