C36H58F3NO — CID 123987722
1-[4-methyl-3-(3-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-4-yl)cyclohexyl]-2-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol (PubChem CID 123987722) has the molecular formula C36H58F3NO and a molecular weight of 577.86 g/mol. Its IUPAC name is 1-[4-methyl-3-(3-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-4-yl)cyclohexyl]-2-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol.
| Compound Name | 1-[4-methyl-3-(3-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-4-yl)cyclohexyl]-2-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123987722 |
| Molecular Formula | C36H58F3NO |
| Molecular Weight | 577.86 g/mol |
| Exact Mass | 577.45 |
| IUPAC Name | 1-[4-methyl-3-(3-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-benzo[7]annulen-4-yl)cyclohexyl]-2-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
| SMILES | C=C(C1CCC(CN2CCC(C)CC2)C(C(F)(F)F)C1)C(O)C1CCC(C)C(C2C3=CCCCCC3CCC2C)C1 |
| InChI | InChI=1S/C36H58F3NO/c1-23-16-18-40(19-17-23)22-30-15-14-28(21-33(30)36(37,38)39)26(4)35(41)29-13-10-24(2)32(20-29)34-25(3)11-12-27-8-6-5-7-9-31(27)34/h9,23-25,27-30,32-35,41H,4-8,10-22H2,1-3H3 |
| InChIKey | HHYPBHVASNTUST-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.86 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|