C40H61F3N2O — CID 123750052
1-[4-methyl-3-(1-methyl-7-pyrrolidin-3-yl-1,6,7,8,9,9a-hexahydrobenzo[7]annulen-4-yl)cyclohexyl]-3-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol (PubChem CID 123750052) has the molecular formula C40H61F3N2O and a molecular weight of 642.94 g/mol. Its IUPAC name is 1-[4-methyl-3-(1-methyl-7-pyrrolidin-3-yl-1,6,7,8,9,9a-hexahydrobenzo[7]annulen-4-yl)cyclohexyl]-3-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol.
| Compound Name | 1-[4-methyl-3-(1-methyl-7-pyrrolidin-3-yl-1,6,7,8,9,9a-hexahydrobenzo[7]annulen-4-yl)cyclohexyl]-3-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123750052 |
| Molecular Formula | C40H61F3N2O |
| Molecular Weight | 642.94 g/mol |
| Exact Mass | 642.47 |
| IUPAC Name | 1-[4-methyl-3-(1-methyl-7-pyrrolidin-3-yl-1,6,7,8,9,9a-hexahydrobenzo[7]annulen-4-yl)cyclohexyl]-3-[4-[(4-methylpiperidin-1-yl)methyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
| SMILES | CC1CCN(CC2CCC(C=CC(O)C3CCC(C)C(C4=C=CC(C)C5CCC(C6CCNC6)CC=C45)C3)CC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C40H61F3N2O/c1-26-17-20-45(21-18-26)25-33-9-6-29(22-38(33)40(41,42)43)7-15-39(46)31-8-4-28(3)37(23-31)36-12-5-27(2)34-13-10-30(11-14-35(34)36)32-16-19-44-24-32/h5,7,14-15,26-34,37-39,44,46H,4,6,8-11,13,16-25H2,1-3H3 |
| InChIKey | AWVCZAAFQBEVOB-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.94 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|