C37H60F3N2O+ — CID 123555625
2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-(10-methyl-10-azoniatricyclo[5.4.0.08,10]undec-1-en-11-yl)cyclohexyl]prop-2-en-1-ol (PubChem CID 123555625) has the molecular formula C37H60F3N2O+ and a molecular weight of 605.89 g/mol. Its IUPAC name is 2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-(10-methyl-10-azoniatricyclo[5.4.0.08,10]undec-1-en-11-yl)cyclohexyl]prop-2-en-1-ol.
| Compound Name | 2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-(10-methyl-10-azoniatricyclo[5.4.0.08,10]undec-1-en-11-yl)cyclohexyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123555625 |
| Molecular Formula | C37H60F3N2O+ |
| Molecular Weight | 605.89 g/mol |
| Exact Mass | 605.47 |
| IUPAC Name | 2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-(10-methyl-10-azoniatricyclo[5.4.0.08,10]undec-1-en-11-yl)cyclohexyl]prop-2-en-1-ol |
| SMILES | C=C(C1CCC(CCC2CCC(NC)CC2)C(C(F)(F)F)C1)C(O)C1CCC(C)C(C2C3=CCCCCC3C3C[N+]32C)C1 |
| InChI | InChI=1S/C37H60F3N2O/c1-23-10-14-28(20-32(23)35-31-9-7-5-6-8-30(31)34-22-42(34,35)4)36(43)24(2)27-17-16-26(33(21-27)37(38,39)40)15-11-25-12-18-29(41-3)19-13-25/h9,23,25-30,32-36,41,43H,2,5-8,10-22H2,1,3-4H3/q+1 |
| InChIKey | BOQHGQYQJXILML-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.89 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|