C37H61F3N2O — CID 123189028
1-[3-(1,2-dimethyl-3,5,6,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-3-yl)-4-methylcyclohexyl]-2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol (PubChem CID 123189028) has the molecular formula C37H61F3N2O and a molecular weight of 606.90 g/mol. Its IUPAC name is 1-[3-(1,2-dimethyl-3,5,6,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-3-yl)-4-methylcyclohexyl]-2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol.
| Compound Name | 1-[3-(1,2-dimethyl-3,5,6,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-3-yl)-4-methylcyclohexyl]-2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123189028 |
| Molecular Formula | C37H61F3N2O |
| Molecular Weight | 606.90 g/mol |
| Exact Mass | 606.47 |
| IUPAC Name | 1-[3-(1,2-dimethyl-3,5,6,7,8,8a-hexahydro-1H-cyclohepta[c]pyrrol-3-yl)-4-methylcyclohexyl]-2-[4-[2-[4-(methylamino)cyclohexyl]ethyl]-3-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
| SMILES | C=C(C1CCC(CCC2CCC(NC)CC2)C(C(F)(F)F)C1)C(O)C1CCC(C)C(C2C3=CCCCCC3C(C)N2C)C1 |
| InChI | InChI=1S/C37H61F3N2O/c1-23-11-15-29(21-33(23)35-32-10-8-6-7-9-31(32)25(3)42(35)5)36(43)24(2)28-18-17-27(34(22-28)37(38,39)40)16-12-26-13-19-30(41-4)20-14-26/h10,23,25-31,33-36,41,43H,2,6-9,11-22H2,1,3-5H3 |
| InChIKey | PFYAFNSPUXMXKE-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.90 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|