C36H59F3N2O2 — CID 123968895
2-[4-[2-[4-[[hydroxy-[4-methyl-3-[(1-methyl-1,2,3,5,6,7,8,8a-octahydrocyclohepta[c]pyrrol-3-yl)methyl]cyclohexyl]methyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexyl]ethanol (PubChem CID 123968895) has the molecular formula C36H59F3N2O2 and a molecular weight of 608.87 g/mol. Its IUPAC name is 2-[4-[2-[4-[[hydroxy-[4-methyl-3-[(1-methyl-1,2,3,5,6,7,8,8a-octahydrocyclohepta[c]pyrrol-3-yl)methyl]cyclohexyl]methyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexyl]ethanol.
| Compound Name | 2-[4-[2-[4-[[hydroxy-[4-methyl-3-[(1-methyl-1,2,3,5,6,7,8,8a-octahydrocyclohepta[c]pyrrol-3-yl)methyl]cyclohexyl]methyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexyl]ethanol |
|---|---|
| PubChem CID | 123968895 |
| Molecular Formula | C36H59F3N2O2 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.45 |
| IUPAC Name | 2-[4-[2-[4-[[hydroxy-[4-methyl-3-[(1-methyl-1,2,3,5,6,7,8,8a-octahydrocyclohepta[c]pyrrol-3-yl)methyl]cyclohexyl]methyl]amino]-2-(trifluoromethyl)cyclohexyl]ethylidene]cyclohexyl]ethanol |
| SMILES | CC1CCC(C(O)NC2CCC(CC=C3CCC(CCO)CC3)C(C(F)(F)F)C2)CC1CC1NC(C)C2CCCCC=C12 |
| InChI | InChI=1S/C36H59F3N2O2/c1-23-8-14-28(20-29(23)21-34-32-7-5-3-4-6-31(32)24(2)40-34)35(43)41-30-17-16-27(33(22-30)36(37,38)39)15-13-25-9-11-26(12-10-25)18-19-42/h7,13,23-24,26-31,33-35,40-43H,3-6,8-12,14-22H2,1-2H3/b25-13- |
| InChIKey | MKHKUDSLGIFYIK-MXAYSNPKSA-N |
| XLogP | 8.05 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|