C14H28O2 — CID 123987895
2-(5-ethyl-2,6-dimethylheptyl)-3-methoxyoxirane (PubChem CID 123987895) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-(5-ethyl-2,6-dimethylheptyl)-3-methoxyoxirane.
| Compound Name | 2-(5-ethyl-2,6-dimethylheptyl)-3-methoxyoxirane |
|---|---|
| PubChem CID | 123987895 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2-(5-ethyl-2,6-dimethylheptyl)-3-methoxyoxirane |
| SMILES | CCC(CCC(C)CC1OC1OC)C(C)C |
| InChI | InChI=1S/C14H28O2/c1-6-12(10(2)3)8-7-11(4)9-13-14(15-5)16-13/h10-14H,6-9H2,1-5H3 |
| InChIKey | SAXOITUHYHAHOW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|