C26H45NO6 — CID 123987932
2-hydroxyethyl 10-[2,5-dihydroxy-1-(2-hydroxyethyl)pyrrol-3-yl]octadec-8-enoate (PubChem CID 123987932) has the molecular formula C26H45NO6 and a molecular weight of 467.65 g/mol. Its IUPAC name is 2-hydroxyethyl 10-[2,5-dihydroxy-1-(2-hydroxyethyl)pyrrol-3-yl]octadec-8-enoate.
| Compound Name | 2-hydroxyethyl 10-[2,5-dihydroxy-1-(2-hydroxyethyl)pyrrol-3-yl]octadec-8-enoate |
|---|---|
| PubChem CID | 123987932 |
| Molecular Formula | C26H45NO6 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.32 |
| IUPAC Name | 2-hydroxyethyl 10-[2,5-dihydroxy-1-(2-hydroxyethyl)pyrrol-3-yl]octadec-8-enoate |
| SMILES | CCCCCCCCC(C=CCCCCCCC(=O)OCCO)c1cc(O)n(CCO)c1O |
| InChI | InChI=1S/C26H45NO6/c1-2-3-4-5-8-11-14-22(23-21-24(30)27(17-18-28)26(23)32)15-12-9-6-7-10-13-16-25(31)33-20-19-29/h12,15,21-22,28-30,32H,2-11,13-14,16-20H2,1H3 |
| InChIKey | JBGVYQFPIRBJPH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|