About N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine
N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine (PubChem CID 123988289) has the molecular formula C18H33NS
and a molecular weight of 295.54 g/mol. Its IUPAC name is N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine.
Molecular Properties
| Compound Name | N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine |
| PubChem CID | 123988289 |
| Molecular Formula | C18H33NS |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine |
| SMILES | CCCCSCC=C(C)CCC=C(C)CCN=C(C)C |
| InChI | InChI=1S/C18H33NS/c1-6-7-14-20-15-12-18(5)10-8-9-17(4)11-13-19-16(2)3/h9,12H,6-8,10-11,13-15H2,1-5H3 |
| InChIKey | GZMMMUDGOPBHSU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine?
The IUPAC name of N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine (CID 123988289) is N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine.
What is the SMILES notation for N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine?
The canonical SMILES for N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine is CCCCSCC=C(C)CCC=C(C)CCN=C(C)C.
What is the InChIKey of N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine?
The InChIKey is GZMMMUDGOPBHSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NS/c1-6-7-14-20-15-12-18(5)10-8-9-17(4)11-13-19-16(2)3/h9,12H,6-8,10-11,13-15H2,1-5H3.
What are the key properties of N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine?
N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine has a molecular weight of 295.54 g/mol, XLogP of 6.06, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-butylsulfanyl-3,7-dimethylnona-3,7-dienyl)propan-2-imine is sourced from PubChem (CID 123988289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).