C25H55NS — CID 172567417
ethane;(3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine;propane (PubChem CID 172567417) has the molecular formula C25H55NS and a molecular weight of 401.79 g/mol. Its IUPAC name is ethane;(3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine;propane.
| Compound Name | ethane;(3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine;propane |
|---|---|
| PubChem CID | 172567417 |
| Molecular Formula | C25H55NS |
| Molecular Weight | 401.79 g/mol |
| Exact Mass | 401.41 |
| IUPAC Name | ethane;(3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine;propane |
| SMILES | CC.CC.CC.CCC.CCCC/C=C(C)\C(=N/C)C(=C\CCSC)\CC |
| InChI | InChI=1S/C16H29NS.C3H8.3C2H6/c1-6-8-9-11-14(3)16(17-4)15(7-2)12-10-13-18-5;1-3-2;3*1-2/h11-12H,6-10,13H2,1-5H3;3H2,1-2H3;3*1-2H3/b14-11-,15-12+,17-16+;;;; |
| InChIKey | JPRNKMXTPZNNRG-RGRHIURRSA-N |
| XLogP | 9.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.79 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|