C12H21NS — CID 143331734
(Z)-5-[(Z)-but-2-en-2-yl]sulfanyl-3-ethyl-N-methylpent-3-en-2-imine (PubChem CID 143331734) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is (Z)-5-[(Z)-but-2-en-2-yl]sulfanyl-3-ethyl-N-methylpent-3-en-2-imine.
| Compound Name | (Z)-5-[(Z)-but-2-en-2-yl]sulfanyl-3-ethyl-N-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 143331734 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (Z)-5-[(Z)-but-2-en-2-yl]sulfanyl-3-ethyl-N-methylpent-3-en-2-imine |
| SMILES | C/C=C(/C)SC/C=C(CC)\C(C)=N\C |
| InChI | InChI=1S/C12H21NS/c1-6-10(3)14-9-8-12(7-2)11(4)13-5/h6,8H,7,9H2,1-5H3/b10-6-,12-8-,13-11+ |
| InChIKey | PNXONUPALHVGQU-KFRVRMDTSA-N |
| XLogP | 4.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|