C11H19NS — CID 143858138
N,5-dimethyl-2-propan-2-ylidenethiophen-3-imine;ethane (PubChem CID 143858138) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is N,5-dimethyl-2-propan-2-ylidenethiophen-3-imine;ethane.
| Compound Name | N,5-dimethyl-2-propan-2-ylidenethiophen-3-imine;ethane |
|---|---|
| PubChem CID | 143858138 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N,5-dimethyl-2-propan-2-ylidenethiophen-3-imine;ethane |
| SMILES | C/N=C1\C=C(C)SC1=C(C)C.CC |
| InChI | InChI=1S/C9H13NS.C2H6/c1-6(2)9-8(10-4)5-7(3)11-9;1-2/h5H,1-4H3;1-2H3/b10-8+; |
| InChIKey | PEJIJUSMGKTBPK-VRTOBVRTSA-N |
| XLogP | 4.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|