C21H45NS — CID 143718215
(Z)-but-2-ene;ethane;(2E)-2-ethylidene-N,4,5-trimethylthiophen-3-imine (PubChem CID 143718215) has the molecular formula C21H45NS and a molecular weight of 343.67 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;(2E)-2-ethylidene-N,4,5-trimethylthiophen-3-imine.
| Compound Name | (Z)-but-2-ene;ethane;(2E)-2-ethylidene-N,4,5-trimethylthiophen-3-imine |
|---|---|
| PubChem CID | 143718215 |
| Molecular Formula | C21H45NS |
| Molecular Weight | 343.67 g/mol |
| Exact Mass | 343.33 |
| IUPAC Name | (Z)-but-2-ene;ethane;(2E)-2-ethylidene-N,4,5-trimethylthiophen-3-imine |
| SMILES | C/C=C1/SC(C)=C(C)/C1=N\C.C/C=C\C.CC.CC.CC.CC |
| InChI | InChI=1S/C9H13NS.C4H8.4C2H6/c1-5-8-9(10-4)6(2)7(3)11-8;1-3-4-2;4*1-2/h5H,1-4H3;3-4H,1-2H3;4*1-2H3/b8-5+,10-9+;4-3-;;;; |
| InChIKey | IXMNETUPFGBWSL-ITABUCRVSA-N |
| XLogP | 8.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.67 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|