C12H21NS — CID 143858158
(2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine;ethane (PubChem CID 143858158) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is (2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine;ethane.
| Compound Name | (2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine;ethane |
|---|---|
| PubChem CID | 143858158 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine;ethane |
| SMILES | CC.CC/C(C)=C1/SC(C)=C/C1=N\C |
| InChI | InChI=1S/C10H15NS.C2H6/c1-5-7(2)10-9(11-4)6-8(3)12-10;1-2/h6H,5H2,1-4H3;1-2H3/b10-7+,11-9+; |
| InChIKey | OXMHUNJSEKWUDF-MIEZCDQOSA-N |
| XLogP | 4.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|