C10H15NS — CID 143858159
(2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine (PubChem CID 143858159) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is (2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine.
| Compound Name | (2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine |
|---|---|
| PubChem CID | 143858159 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (2E)-2-butan-2-ylidene-N,5-dimethylthiophen-3-imine |
| SMILES | CC/C(C)=C1/SC(C)=C/C1=N\C |
| InChI | InChI=1S/C10H15NS/c1-5-7(2)10-9(11-4)6-8(3)12-10/h6H,5H2,1-4H3/b10-7+,11-9+ |
| InChIKey | HYZQAWRNIMAARI-PPZOTWNKSA-N |
| XLogP | 3.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|