C16H29NS — CID 172567418
(3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine (PubChem CID 172567418) has the molecular formula C16H29NS and a molecular weight of 267.48 g/mol. Its IUPAC name is (3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine.
| Compound Name | (3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine |
|---|---|
| PubChem CID | 172567418 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (3E,6Z)-4-ethyl-N,6-dimethyl-1-methylsulfanylundeca-3,6-dien-5-imine |
| SMILES | CCCC/C=C(C)\C(=N/C)C(=C\CCSC)\CC |
| InChI | InChI=1S/C16H29NS/c1-6-8-9-11-14(3)16(17-4)15(7-2)12-10-13-18-5/h11-12H,6-10,13H2,1-5H3/b14-11-,15-12+,17-16+ |
| InChIKey | SYBNRVGWAKTQMJ-PCEPNREMSA-N |
| XLogP | 5.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|