C16H13ClF2O2 — CID 123989589
3-(4-chlorophenyl)-3-(3,5-difluorophenyl)-2-methylpropanoic acid (PubChem CID 123989589) has the molecular formula C16H13ClF2O2 and a molecular weight of 310.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(3,5-difluorophenyl)-2-methylpropanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-(3,5-difluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 123989589 |
| Molecular Formula | C16H13ClF2O2 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(3,5-difluorophenyl)-2-methylpropanoic acid |
| SMILES | CC(C(=O)O)C(c1ccc(Cl)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H13ClF2O2/c1-9(16(20)21)15(10-2-4-12(17)5-3-10)11-6-13(18)8-14(19)7-11/h2-9,15H,1H3,(H,20,21) |
| InChIKey | PQGFJYMTNOPXHQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |