C25H31N3O3 — CID 123989616
4-(1,3-benzoxazol-2-yl)-N-[3-[(butan-2-ylamino)-hydroxymethyl]cyclopentyl]-N-methylbenzamide (PubChem CID 123989616) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-[3-[(butan-2-ylamino)-hydroxymethyl]cyclopentyl]-N-methylbenzamide.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-[3-[(butan-2-ylamino)-hydroxymethyl]cyclopentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 123989616 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-[3-[(butan-2-ylamino)-hydroxymethyl]cyclopentyl]-N-methylbenzamide |
| SMILES | CCC(C)NC(O)C1CCC(N(C)C(=O)c2ccc(-c3nc4ccccc4o3)cc2)C1 |
| InChI | InChI=1S/C25H31N3O3/c1-4-16(2)26-23(29)19-13-14-20(15-19)28(3)25(30)18-11-9-17(10-12-18)24-27-21-7-5-6-8-22(21)31-24/h5-12,16,19-20,23,26,29H,4,13-15H2,1-3H3 |
| InChIKey | YFNRVWGWRVHGHW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|