C21H23N5O2 — CID 154652917
N-[3-[amino-[(Z)-2-amino-1-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]amino]cyclopentyl]formamide (PubChem CID 154652917) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[3-[amino-[(Z)-2-amino-1-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]amino]cyclopentyl]formamide.
| Compound Name | N-[3-[amino-[(Z)-2-amino-1-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]amino]cyclopentyl]formamide |
|---|---|
| PubChem CID | 154652917 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[3-[amino-[(Z)-2-amino-1-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]amino]cyclopentyl]formamide |
| SMILES | N/C=C(/c1ccc(-c2nc3ccccc3o2)cc1)N(N)C1CCC(NC=O)C1 |
| InChI | InChI=1S/C21H23N5O2/c22-12-19(26(23)17-10-9-16(11-17)24-13-27)14-5-7-15(8-6-14)21-25-18-3-1-2-4-20(18)28-21/h1-8,12-13,16-17H,9-11,22-23H2,(H,24,27)/b19-12- |
| InChIKey | VYWQDVVOFCQBAB-UNOMPAQXSA-N |
| XLogP | 2.59 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|