C26H35N3O4 — CID 144627040
4-(1,3-benzoxazol-2-yl)-N-methylbenzamide;N-(1-hydroxy-2-methylpropan-2-yl)formamide;methylcyclopentane (PubChem CID 144627040) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-methylbenzamide;N-(1-hydroxy-2-methylpropan-2-yl)formamide;methylcyclopentane.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-methylbenzamide;N-(1-hydroxy-2-methylpropan-2-yl)formamide;methylcyclopentane |
|---|---|
| PubChem CID | 144627040 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-methylbenzamide;N-(1-hydroxy-2-methylpropan-2-yl)formamide;methylcyclopentane |
| SMILES | CC(C)(CO)NC=O.CC1CCCC1.CNC(=O)c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C15H12N2O2.C6H12.C5H11NO2/c1-16-14(18)10-6-8-11(9-7-10)15-17-12-4-2-3-5-13(12)19-15;1-6-4-2-3-5-6;1-5(2,3-7)6-4-8/h2-9H,1H3,(H,16,18);6H,2-5H2,1H3;4,7H,3H2,1-2H3,(H,6,8) |
| InChIKey | LCMSBCYEMFJVAW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|