C12H19FN2 — CID 123991439
(4E)-5-fluoro-N-(3-methylpiperidin-4-yl)hexa-1,4-dien-3-imine (PubChem CID 123991439) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is (4E)-5-fluoro-N-(3-methylpiperidin-4-yl)hexa-1,4-dien-3-imine.
| Compound Name | (4E)-5-fluoro-N-(3-methylpiperidin-4-yl)hexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123991439 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (4E)-5-fluoro-N-(3-methylpiperidin-4-yl)hexa-1,4-dien-3-imine |
| SMILES | C=CC(/C=C(\C)F)=N\C1CCNCC1C |
| InChI | InChI=1S/C12H19FN2/c1-4-11(7-10(3)13)15-12-5-6-14-8-9(12)2/h4,7,9,12,14H,1,5-6,8H2,2-3H3/b10-7+,15-11+ |
| InChIKey | ZPAOICICEJPXIP-UNRYZTPYSA-N |
| XLogP | 2.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|