C9H16N2 — CID 143605430
(3Z)-3-ethylidene-N,5-dimethylpiperidin-4-imine (PubChem CID 143605430) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3Z)-3-ethylidene-N,5-dimethylpiperidin-4-imine.
| Compound Name | (3Z)-3-ethylidene-N,5-dimethylpiperidin-4-imine |
|---|---|
| PubChem CID | 143605430 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3Z)-3-ethylidene-N,5-dimethylpiperidin-4-imine |
| SMILES | C/C=C1/CNCC(C)/C1=N\C |
| InChI | InChI=1S/C9H16N2/c1-4-8-6-11-5-7(2)9(8)10-3/h4,7,11H,5-6H2,1-3H3/b8-4-,10-9+ |
| InChIKey | RHBRGGVUSAXPTO-CCAISUFFSA-N |
| XLogP | 1.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|