C29H45F2NO2 — CID 123993869
6-(2,5-difluorocyclohexyl)-2-hept-5-en-3-yl-4-methyl-8-(oxan-4-ylmethoxy)-1,2,3,5,6,8a-hexahydroquinoline (PubChem CID 123993869) has the molecular formula C29H45F2NO2 and a molecular weight of 477.68 g/mol. Its IUPAC name is 6-(2,5-difluorocyclohexyl)-2-hept-5-en-3-yl-4-methyl-8-(oxan-4-ylmethoxy)-1,2,3,5,6,8a-hexahydroquinoline.
| Compound Name | 6-(2,5-difluorocyclohexyl)-2-hept-5-en-3-yl-4-methyl-8-(oxan-4-ylmethoxy)-1,2,3,5,6,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 123993869 |
| Molecular Formula | C29H45F2NO2 |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | 6-(2,5-difluorocyclohexyl)-2-hept-5-en-3-yl-4-methyl-8-(oxan-4-ylmethoxy)-1,2,3,5,6,8a-hexahydroquinoline |
| SMILES | CC=CCC(CC)C1CC(C)=C2CC(C3CC(F)CCC3F)C=C(OCC3CCOCC3)C2N1 |
| InChI | InChI=1S/C29H45F2NO2/c1-4-6-7-21(5-2)27-14-19(3)24-15-22(25-17-23(30)8-9-26(25)31)16-28(29(24)32-27)34-18-20-10-12-33-13-11-20/h4,6,16,20-23,25-27,29,32H,5,7-15,17-18H2,1-3H3 |
| InChIKey | DTVPTHLVRKVAIM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|