C35H58FNO — CID 123593176
N-(1-cyclohex-3-en-1-ylethyl)-6-(1-cyclopropylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-2-octoxycyclohex-2-en-1-amine (PubChem CID 123593176) has the molecular formula C35H58FNO and a molecular weight of 527.85 g/mol. Its IUPAC name is N-(1-cyclohex-3-en-1-ylethyl)-6-(1-cyclopropylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-2-octoxycyclohex-2-en-1-amine.
| Compound Name | N-(1-cyclohex-3-en-1-ylethyl)-6-(1-cyclopropylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-2-octoxycyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 123593176 |
| Molecular Formula | C35H58FNO |
| Molecular Weight | 527.85 g/mol |
| Exact Mass | 527.45 |
| IUPAC Name | N-(1-cyclohex-3-en-1-ylethyl)-6-(1-cyclopropylethyl)-4-(3-ethyl-5-fluorocyclohex-2-en-1-yl)-2-octoxycyclohex-2-en-1-amine |
| SMILES | CCCCCCCCOC1=CC(C2C=C(CC)CC(F)C2)CC(C(C)C2CC2)C1NC(C)C1CC=CCC1 |
| InChI | InChI=1S/C35H58FNO/c1-5-7-8-9-10-14-19-38-34-24-31(30-20-27(6-2)21-32(36)22-30)23-33(25(3)28-17-18-28)35(34)37-26(4)29-15-12-11-13-16-29/h11-12,20,24-26,28-33,35,37H,5-10,13-19,21-23H2,1-4H3 |
| InChIKey | YYAXUKUIVXLNQZ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.85 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|