C16H18ClN3O2 — CID 123994106
benzyl N-[1-(5-chloro-2-methyl-5H-pyrimidin-2-yl)cyclopropyl]carbamate (PubChem CID 123994106) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is benzyl N-[1-(5-chloro-2-methyl-5H-pyrimidin-2-yl)cyclopropyl]carbamate.
| Compound Name | benzyl N-[1-(5-chloro-2-methyl-5H-pyrimidin-2-yl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 123994106 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | benzyl N-[1-(5-chloro-2-methyl-5H-pyrimidin-2-yl)cyclopropyl]carbamate |
| SMILES | CC1(C2(NC(=O)OCc3ccccc3)CC2)N=CC(Cl)C=N1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-15(18-9-13(17)10-19-15)16(7-8-16)20-14(21)22-11-12-5-3-2-4-6-12/h2-6,9-10,13H,7-8,11H2,1H3,(H,20,21) |
| InChIKey | NUETUDCGNFFPLP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|