C19H31N2+ — CID 123997167
2,4-ditert-butyl-1-(4-ethyl-5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium (PubChem CID 123997167) has the molecular formula C19H31N2+ and a molecular weight of 287.47 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-(4-ethyl-5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium.
| Compound Name | 2,4-ditert-butyl-1-(4-ethyl-5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium |
|---|---|
| PubChem CID | 123997167 |
| Molecular Formula | C19H31N2+ |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | 2,4-ditert-butyl-1-(4-ethyl-5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium |
| SMILES | CCC1CC=C([N+]2=C(C(C)(C)C)N=C2C(C)(C)C)C=C1C |
| InChI | InChI=1S/C19H31N2/c1-9-14-10-11-15(12-13(14)2)21-16(18(3,4)5)20-17(21)19(6,7)8/h11-12,14H,9-10H2,1-8H3/q+1 |
| InChIKey | PARSFPMBGGWEKC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|