C17H27N2+ — CID 123482182
2,4-ditert-butyl-1-(5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium (PubChem CID 123482182) has the molecular formula C17H27N2+ and a molecular weight of 259.42 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-(5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium.
| Compound Name | 2,4-ditert-butyl-1-(5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium |
|---|---|
| PubChem CID | 123482182 |
| Molecular Formula | C17H27N2+ |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.22 |
| IUPAC Name | 2,4-ditert-butyl-1-(5-methylcyclohexa-1,5-dien-1-yl)-1,3-diazet-1-ium |
| SMILES | CC1=CC([N+]2=C(C(C)(C)C)N=C2C(C)(C)C)=CCC1 |
| InChI | InChI=1S/C17H27N2/c1-12-9-8-10-13(11-12)19-14(16(2,3)4)18-15(19)17(5,6)7/h10-11H,8-9H2,1-7H3/q+1 |
| InChIKey | CJTAODDERXAYIX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|