C16H19N2W+ — CID 20657540
1-(2,4-dimethylbenzene-5-id-1-yl)-2,4,5-trimethyl-6-methylidenepyrimidine;tungsten(2+) (PubChem CID 20657540) has the molecular formula C16H19N2W+ and a molecular weight of 423.18 g/mol. Its IUPAC name is 1-(2,4-dimethylbenzene-5-id-1-yl)-2,4,5-trimethyl-6-methylidenepyrimidine;tungsten(2+).
| Compound Name | 1-(2,4-dimethylbenzene-5-id-1-yl)-2,4,5-trimethyl-6-methylidenepyrimidine;tungsten(2+) |
|---|---|
| PubChem CID | 20657540 |
| Molecular Formula | C16H19N2W+ |
| Molecular Weight | 423.18 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 1-(2,4-dimethylbenzene-5-id-1-yl)-2,4,5-trimethyl-6-methylidenepyrimidine;tungsten(2+) |
| SMILES | C=C1C(C)=C(C)N=C(C)N1c1c[c-]c(C)cc1C.[W+2] |
| InChI | InChI=1S/C16H19N2.W/c1-10-7-8-16(11(2)9-10)18-14(5)12(3)13(4)17-15(18)6;/h8-9H,5H2,1-4,6H3;/q-1;+2 |
| InChIKey | GYRGSKOSKYHPMA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.18 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|