C17H17N2W- — CID 59972574
1-(2,4-dimethylbenzene-5-id-1-yl)-2-ethynyl-4,5-dimethyl-6-methylidenepyrimidine;tungsten (PubChem CID 59972574) has the molecular formula C17H17N2W- and a molecular weight of 433.18 g/mol. Its IUPAC name is 1-(2,4-dimethylbenzene-5-id-1-yl)-2-ethynyl-4,5-dimethyl-6-methylidenepyrimidine;tungsten.
| Compound Name | 1-(2,4-dimethylbenzene-5-id-1-yl)-2-ethynyl-4,5-dimethyl-6-methylidenepyrimidine;tungsten |
|---|---|
| PubChem CID | 59972574 |
| Molecular Formula | C17H17N2W- |
| Molecular Weight | 433.18 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-(2,4-dimethylbenzene-5-id-1-yl)-2-ethynyl-4,5-dimethyl-6-methylidenepyrimidine;tungsten |
| SMILES | C#CC1=NC(C)=C(C)C(=C)N1c1c[c-]c(C)cc1C.[W] |
| InChI | InChI=1S/C17H17N2.W/c1-7-17-18-14(5)13(4)15(6)19(17)16-9-8-11(2)10-12(16)3;/h1,9-10H,6H2,2-5H3;/q-1; |
| InChIKey | JDNHSLPLQYQJHG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|