C18H28N2O4 — CID 123997862
tert-butyl 5-[(3-methoxy-4-methyl-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylate (PubChem CID 123997862) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl 5-[(3-methoxy-4-methyl-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 5-[(3-methoxy-4-methyl-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123997862 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl 5-[(3-methoxy-4-methyl-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylate |
| SMILES | COc1c(C)ccnc1OC1CCC(C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H28N2O4/c1-12-9-10-19-16(15(12)22-6)23-14-8-7-13(2)20(11-14)17(21)24-18(3,4)5/h9-10,13-14H,7-8,11H2,1-6H3 |
| InChIKey | JGVTWFYNSLXJKS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |