C19H33NO — CID 123999702
N-[3-(1-adamantyl)-2,4-dimethylpentan-2-yl]acetamide (PubChem CID 123999702) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is N-[3-(1-adamantyl)-2,4-dimethylpentan-2-yl]acetamide.
| Compound Name | N-[3-(1-adamantyl)-2,4-dimethylpentan-2-yl]acetamide |
|---|---|
| PubChem CID | 123999702 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | N-[3-(1-adamantyl)-2,4-dimethylpentan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)C(C(C)C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H33NO/c1-12(2)17(18(4,5)20-13(3)21)19-9-14-6-15(10-19)8-16(7-14)11-19/h12,14-17H,6-11H2,1-5H3,(H,20,21) |
| InChIKey | UASTWQSSZAKVEQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |