C19H24N4O3 — CID 124044096
5-(2-{3-[2-(Cyclopropylmethoxy)ethyl]-1,2,4-oxadiazol-5-YL}pyrrolidine-1-carbonyl)-2-methylpyridine (PubChem CID 124044096) has the molecular formula C19H24N4O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is [2-[3-[2-(cyclopropylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | 5-(2-{3-[2-(Cyclopropylmethoxy)ethyl]-1,2,4-oxadiazol-5-YL}pyrrolidine-1-carbonyl)-2-methylpyridine |
|---|---|
| PubChem CID | 124044096 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [2-[3-[2-(cyclopropylmethoxy)ethyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | CC1=NC=C(C=C1)C(=O)N2CCCC2C3=NC(=NO3)CCOCC4CC4 |
| InChI | InChI=1S/C19H24N4O3/c1-13-4-7-15(11-20-13)19(24)23-9-2-3-16(23)18-21-17(22-26-18)8-10-25-12-14-5-6-14/h4,7,11,14,16H,2-3,5-6,8-10,12H2,1H3 |
| InChIKey | JGGILXLQULQDLL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | 487 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|