C24H25N5O4 — CID 1240450
(4S)-4-(3,4-dimethoxyphenyl)-6-methyl-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 1240450) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is (4S)-4-(3,4-dimethoxyphenyl)-6-methyl-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4S)-4-(3,4-dimethoxyphenyl)-6-methyl-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 1240450 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (4S)-4-(3,4-dimethoxyphenyl)-6-methyl-N-[(2-methyl-1H-indol-3-yl)methylideneamino]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | COc1ccc([C@@H]2NC(=O)NC(C)=C2C(=O)NN=Cc2c(C)[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C24H25N5O4/c1-13-17(16-7-5-6-8-18(16)26-13)12-25-29-23(30)21-14(2)27-24(31)28-22(21)15-9-10-19(32-3)20(11-15)33-4/h5-12,22,26H,1-4H3,(H,29,30)(H2,27,28,31)/t22-/m0/s1 |
| InChIKey | NZHMQMFRWQQUTH-QFIPXVFZSA-N |
| XLogP | 3.27 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|