C18H16IN3O2 — CID 135931425
3-iodo-4-methoxy-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide (PubChem CID 135931425) has the molecular formula C18H16IN3O2 and a molecular weight of 433.25 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide.
| Compound Name | 3-iodo-4-methoxy-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135931425 |
| Molecular Formula | C18H16IN3O2 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 3-iodo-4-methoxy-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2c(C)[nH]c3ccccc23)cc1I |
| InChI | InChI=1S/C18H16IN3O2/c1-11-14(13-5-3-4-6-16(13)21-11)10-20-22-18(23)12-7-8-17(24-2)15(19)9-12/h3-10,21H,1-2H3,(H,22,23)/b20-10- |
| InChIKey | DRGHZNKXHQYQDZ-JMIUGGIZSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|