C18H20N2O3S2 — CID 1242830
5-benzylidene-3-(4-morpholin-4-yl-4-oxobutyl)-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 1242830) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 5-benzylidene-3-(4-morpholin-4-yl-4-oxobutyl)-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | 5-benzylidene-3-(4-morpholin-4-yl-4-oxobutyl)-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 1242830 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-benzylidene-3-(4-morpholin-4-yl-4-oxobutyl)-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C(CCCN1C(=O)SC(=Cc2ccccc2)C1=S)N1CCOCC1 |
| InChI | InChI=1S/C18H20N2O3S2/c21-16(19-9-11-23-12-10-19)7-4-8-20-17(24)15(25-18(20)22)13-14-5-2-1-3-6-14/h1-3,5-6,13H,4,7-12H2 |
| InChIKey | COBDLPXRVVFIAP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|