C21H17N2O4S2- — CID 3524630
3-[4-(5-benzylidene-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl)butanoylamino]benzoate (PubChem CID 3524630) has the molecular formula C21H17N2O4S2- and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[4-(5-benzylidene-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl)butanoylamino]benzoate.
| Compound Name | 3-[4-(5-benzylidene-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 3524630 |
| Molecular Formula | C21H17N2O4S2- |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 3-[4-(5-benzylidene-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl)butanoylamino]benzoate |
| SMILES | O=C(CCCN1C(=O)SC(=Cc2ccccc2)C1=S)Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C21H18N2O4S2/c24-18(22-16-9-4-8-15(13-16)20(25)26)10-5-11-23-19(28)17(29-21(23)27)12-14-6-2-1-3-7-14/h1-4,6-9,12-13H,5,10-11H2,(H,22,24)(H,25,26)/p-1 |
| InChIKey | YFAPFDRRUXKZBJ-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|