About Tetrapropylammonium iodide
Tetrapropylammonium iodide (PubChem CID 12429) has the molecular formula C12H28IN
and a molecular weight of 313.26 g/mol. Its IUPAC name is tetrapropylazanium iodide.
Molecular Properties
| Compound Name | Tetrapropylammonium iodide |
| PubChem CID | 12429 |
| Molecular Formula | C12H28IN |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | tetrapropylazanium iodide |
| SMILES | CCC[N+](CCC)(CCC)CCC.[I-] |
| InChI | InChI=1S/C12H28N.HI/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | GKXDJYKZFZVASJ-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | 80 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Tetrapropylammonium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tetrapropylammonium iodide?
The IUPAC name of Tetrapropylammonium iodide (CID 12429) is tetrapropylazanium iodide.
What is the SMILES notation for Tetrapropylammonium iodide?
The canonical SMILES for Tetrapropylammonium iodide is CCC[N+](CCC)(CCC)CCC.[I-].
What is the InChIKey of Tetrapropylammonium iodide?
The InChIKey is GKXDJYKZFZVASJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.HI/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of Tetrapropylammonium iodide?
Tetrapropylammonium iodide has a molecular weight of 313.26 g/mol, XLogP of not available, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Tetrapropylammonium iodide is sourced from PubChem (CID 12429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).