About tetrapropylazanium hydroxide
tetrapropylazanium hydroxide (PubChem CID 20586) has the molecular formula C12H29NO
and a molecular weight of 203.37 g/mol. Its IUPAC name is tetrapropylazanium hydroxide.
Molecular Properties
| Compound Name | tetrapropylazanium hydroxide |
| PubChem CID | 20586 |
| Molecular Formula | C12H29NO |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.22 |
| IUPAC Name | tetrapropylazanium hydroxide |
| SMILES | CCC[N+](CCC)(CCC)CCC.[OH-] |
| InChI | InChI=1S/C12H28N.H2O/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | LPSKDVINWQNWFE-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrapropylazanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropylazanium hydroxide?
The IUPAC name of tetrapropylazanium hydroxide (CID 20586) is tetrapropylazanium hydroxide.
What is the SMILES notation for tetrapropylazanium hydroxide?
The canonical SMILES for tetrapropylazanium hydroxide is CCC[N+](CCC)(CCC)CCC.[OH-].
What is the InChIKey of tetrapropylazanium hydroxide?
The InChIKey is LPSKDVINWQNWFE-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.H2O/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H2/q+1;/p-1.
What are the key properties of tetrapropylazanium hydroxide?
tetrapropylazanium hydroxide has a molecular weight of 203.37 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylazanium hydroxide is sourced from PubChem (CID 20586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).