2-sulfobenzoic acid

C7H6O5S — CID 12438

IUPAC2-sulfobenzoic acid
SMILESO=C(O)c1ccccc1S(=O)(=O)O
InChIInChI=1S/C7H6O5S/c8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12)
InChIKeyZMPRRFPMMJQXPP-UHFFFAOYSA-N
MW202.19 g/mol
LogP0.63
Rot. Bonds2

About 2-sulfobenzoic acid

2-sulfobenzoic acid (PubChem CID 12438) has the molecular formula C7H6O5S and a molecular weight of 202.19 g/mol. Its IUPAC name is 2-sulfobenzoic acid.

Molecular Properties

Compound Name2-sulfobenzoic acid
PubChem CID12438
Molecular FormulaC7H6O5S
Molecular Weight202.19 g/mol
Exact Mass201.99
IUPAC Name2-sulfobenzoic acid
SMILESO=C(O)c1ccccc1S(=O)(=O)O
InChIInChI=1S/C7H6O5S/c8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12)
InChIKeyZMPRRFPMMJQXPP-UHFFFAOYSA-N
XLogP0.63
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.19
LogP ≤ 50.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-sulfobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-sulfobenzoic acid?
The IUPAC name of 2-sulfobenzoic acid (CID 12438) is 2-sulfobenzoic acid.
What is the SMILES notation for 2-sulfobenzoic acid?
The canonical SMILES for 2-sulfobenzoic acid is O=C(O)c1ccccc1S(=O)(=O)O.
What is the InChIKey of 2-sulfobenzoic acid?
The InChIKey is ZMPRRFPMMJQXPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5S/c8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12).
What are the key properties of 2-sulfobenzoic acid?
2-sulfobenzoic acid has a molecular weight of 202.19 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfobenzoic acid is sourced from PubChem (CID 12438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).