C21H20N2O — CID 124501657
(S)-[6-(2,3-dihydroindol-1-yl)-5-methyl-3-pyridinyl]-phenylmethanol (PubChem CID 124501657) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is (S)-[6-(2,3-dihydroindol-1-yl)-5-methyl-3-pyridinyl]-phenylmethanol.
| Compound Name | (S)-[6-(2,3-dihydroindol-1-yl)-5-methyl-3-pyridinyl]-phenylmethanol |
|---|---|
| PubChem CID | 124501657 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (S)-[6-(2,3-dihydroindol-1-yl)-5-methyl-3-pyridinyl]-phenylmethanol |
| SMILES | Cc1cc([C@@H](O)c2ccccc2)cnc1N1CCc2ccccc21 |
| InChI | InChI=1S/C21H20N2O/c1-15-13-18(20(24)17-8-3-2-4-9-17)14-22-21(15)23-12-11-16-7-5-6-10-19(16)23/h2-10,13-14,20,24H,11-12H2,1H3/t20-/m0/s1 |
| InChIKey | URJZUAXWJUGCRP-FQEVSTJZSA-N |
| XLogP | 4.17 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |