About 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine
2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine (PubChem CID 124504714) has the molecular formula C9H19N3S
and a molecular weight of 201.34 g/mol. Its IUPAC name is 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine.
Molecular Properties
| Compound Name | 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine |
| PubChem CID | 124504714 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine |
| SMILES | CC/N=C(\N)N[C@@H]1CC[C@H](SC)C1 |
| InChI | InChI=1S/C9H19N3S/c1-3-11-9(10)12-7-4-5-8(6-7)13-2/h7-8H,3-6H2,1-2H3,(H3,10,11,12)/t7-,8+/m1/s1 |
| InChIKey | SSKAJTSKEVHBGZ-SFYZADRCSA-N |
| XLogP | 1.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine?
The IUPAC name of 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine (CID 124504714) is 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine.
What is the SMILES notation for 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine?
The canonical SMILES for 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine is CC/N=C(\N)N[C@@H]1CC[C@H](SC)C1.
What is the InChIKey of 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine?
The InChIKey is SSKAJTSKEVHBGZ-SFYZADRCSA-N. The full InChI is InChI=1S/C9H19N3S/c1-3-11-9(10)12-7-4-5-8(6-7)13-2/h7-8H,3-6H2,1-2H3,(H3,10,11,12)/t7-,8+/m1/s1.
What are the key properties of 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine?
2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine has a molecular weight of 201.34 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine is sourced from PubChem (CID 124504714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).