C9H19N3S — CID 124504714
2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine (PubChem CID 124504714) has the molecular formula C9H19N3S and a molecular weight of 201.34 g/mol. Its IUPAC name is 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine.
| Compound Name | 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine |
|---|---|
| PubChem CID | 124504714 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-ethyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]guanidine |
| SMILES | CC/N=C(\N)N[C@@H]1CC[C@H](SC)C1 |
| InChI | InChI=1S/C9H19N3S/c1-3-11-9(10)12-7-4-5-8(6-7)13-2/h7-8H,3-6H2,1-2H3,(H3,10,11,12)/t7-,8+/m1/s1 |
| InChIKey | SSKAJTSKEVHBGZ-SFYZADRCSA-N |
| XLogP | 1.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|