About (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one
(3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one (PubChem CID 124505781) has the molecular formula C19H24N4O2
and a molecular weight of 340.43 g/mol. Its IUPAC name is (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one |
| PubChem CID | 124505781 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one |
| SMILES | Cc1cnc(CN2CCN([C@H]3CCN(c4ccccc4)C3=O)CC2)o1 |
| InChI | InChI=1S/C19H24N4O2/c1-15-13-20-18(25-15)14-21-9-11-22(12-10-21)17-7-8-23(19(17)24)16-5-3-2-4-6-16/h2-6,13,17H,7-12,14H2,1H3/t17-/m0/s1 |
| InChIKey | NJDFLKPASLKTQR-KRWDZBQOSA-N |
| XLogP | 1.91 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one?
The IUPAC name of (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one (CID 124505781) is (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one.
What is the SMILES notation for (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one?
The canonical SMILES for (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one is Cc1cnc(CN2CCN([C@H]3CCN(c4ccccc4)C3=O)CC2)o1.
What is the InChIKey of (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one?
The InChIKey is NJDFLKPASLKTQR-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H24N4O2/c1-15-13-20-18(25-15)14-21-9-11-22(12-10-21)17-7-8-23(19(17)24)16-5-3-2-4-6-16/h2-6,13,17H,7-12,14H2,1H3/t17-/m0/s1.
What are the key properties of (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one?
(3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one has a molecular weight of 340.43 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 124505781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).