C17H16N4OS — CID 1245081
(2R)-2-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 1245081) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is (2R)-2-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | (2R)-2-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 1245081 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2R)-2-phenyl-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CC[C@@H](C(=O)Nc1nnc(-c2ccncc2)s1)c1ccccc1 |
| InChI | InChI=1S/C17H16N4OS/c1-2-14(12-6-4-3-5-7-12)15(22)19-17-21-20-16(23-17)13-8-10-18-11-9-13/h3-11,14H,2H2,1H3,(H,19,21,22)/t14-/m1/s1 |
| InChIKey | AADQDOVXNOIIGA-CQSZACIVSA-N |
| XLogP | 3.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |