C20H22N4OS — CID 56553192
2-(diethylamino)-2-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 56553192) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-(diethylamino)-2-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(diethylamino)-2-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 56553192 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(diethylamino)-2-phenyl-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCN(CC)C(C(=O)Nc1nnc(-c2ccccc2)s1)c1ccccc1 |
| InChI | InChI=1S/C20H22N4OS/c1-3-24(4-2)17(15-11-7-5-8-12-15)18(25)21-20-23-22-19(26-20)16-13-9-6-10-14-16/h5-14,17H,3-4H2,1-2H3,(H,21,23,25) |
| InChIKey | JCBAYENDBYNBIW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |