About (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol
(2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol (PubChem CID 124508201) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol |
| PubChem CID | 124508201 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol |
| SMILES | Cc1csc(CN(C[C@@H](C)O)c2ccccc2)n1 |
| InChI | InChI=1S/C14H18N2OS/c1-11-10-18-14(15-11)9-16(8-12(2)17)13-6-4-3-5-7-13/h3-7,10,12,17H,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | OUQDXTAHVRJFSC-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol?
The IUPAC name of (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol (CID 124508201) is (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol.
What is the SMILES notation for (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol?
The canonical SMILES for (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol is Cc1csc(CN(C[C@@H](C)O)c2ccccc2)n1.
What is the InChIKey of (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol?
The InChIKey is OUQDXTAHVRJFSC-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-11-10-18-14(15-11)9-16(8-12(2)17)13-6-4-3-5-7-13/h3-7,10,12,17H,8-9H2,1-2H3/t12-/m1/s1.
What are the key properties of (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol?
(2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol has a molecular weight of 262.38 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[N-[(4-methyl-1,3-thiazol-2-yl)methyl]anilino]propan-2-ol is sourced from PubChem (CID 124508201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).