C16H28N2O3S — CID 124508288
N-[[(3S)-3-hydroxythiolan-3-yl]methyl]-2-(1-morpholin-4-ylcyclopentyl)acetamide (PubChem CID 124508288) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is N-[[(3S)-3-hydroxythiolan-3-yl]methyl]-2-(1-morpholin-4-ylcyclopentyl)acetamide.
| Compound Name | N-[[(3S)-3-hydroxythiolan-3-yl]methyl]-2-(1-morpholin-4-ylcyclopentyl)acetamide |
|---|---|
| PubChem CID | 124508288 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[[(3S)-3-hydroxythiolan-3-yl]methyl]-2-(1-morpholin-4-ylcyclopentyl)acetamide |
| SMILES | O=C(CC1(N2CCOCC2)CCCC1)NC[C@@]1(O)CCSC1 |
| InChI | InChI=1S/C16H28N2O3S/c19-14(17-12-16(20)5-10-22-13-16)11-15(3-1-2-4-15)18-6-8-21-9-7-18/h20H,1-13H2,(H,17,19)/t16-/m0/s1 |
| InChIKey | MBOMEEMECORQER-INIZCTEOSA-N |
| XLogP | 1.01 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |