C6H10F3NO — CID 124508872
(2S,5R)-5-methyl-2-(trifluoromethyl)morpholine (PubChem CID 124508872) has the molecular formula C6H10F3NO and a molecular weight of 169.15 g/mol. Its IUPAC name is (2S,5R)-5-methyl-2-(trifluoromethyl)morpholine.
| Compound Name | (2S,5R)-5-methyl-2-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 124508872 |
| Molecular Formula | C6H10F3NO |
| Molecular Weight | 169.15 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (2S,5R)-5-methyl-2-(trifluoromethyl)morpholine |
| SMILES | C[C@@H]1CO[C@H](C(F)(F)F)CN1 |
| InChI | InChI=1S/C6H10F3NO/c1-4-3-11-5(2-10-4)6(7,8)9/h4-5,10H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | LUMNOIAAEIAHKT-UHNVWZDZSA-N |
| XLogP | 0.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |