C9H18N2O3 — CID 124511602
methyl (2S)-2-(dimethylcarbamoylamino)-3-methylbutanoate (PubChem CID 124511602) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl (2S)-2-(dimethylcarbamoylamino)-3-methylbutanoate.
| Compound Name | methyl (2S)-2-(dimethylcarbamoylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 124511602 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | methyl (2S)-2-(dimethylcarbamoylamino)-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C9H18N2O3/c1-6(2)7(8(12)14-5)10-9(13)11(3)4/h6-7H,1-5H3,(H,10,13)/t7-/m0/s1 |
| InChIKey | FKFRNRIOBLRGQW-ZETCQYMHSA-N |
| XLogP | 0.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |