C14H16ClNO5 — CID 124513245
(3R)-4-[2-(5-chloro-2-methoxyphenyl)acetyl]morpholine-3-carboxylic acid (PubChem CID 124513245) has the molecular formula C14H16ClNO5 and a molecular weight of 313.74 g/mol. Its IUPAC name is (3R)-4-[2-(5-chloro-2-methoxyphenyl)acetyl]morpholine-3-carboxylic acid.
| Compound Name | (3R)-4-[2-(5-chloro-2-methoxyphenyl)acetyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 124513245 |
| Molecular Formula | C14H16ClNO5 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (3R)-4-[2-(5-chloro-2-methoxyphenyl)acetyl]morpholine-3-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1CC(=O)N1CCOC[C@@H]1C(=O)O |
| InChI | InChI=1S/C14H16ClNO5/c1-20-12-3-2-10(15)6-9(12)7-13(17)16-4-5-21-8-11(16)14(18)19/h2-3,6,11H,4-5,7-8H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | MTOFMOFACVSPPG-LLVKDONJSA-N |
| XLogP | 1.20 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |